C11H13F3O2S — CID 129132136
1-methyl-4-(4,4,4-trifluorobutylsulfonyl)benzene (PubChem CID 129132136) has the molecular formula C11H13F3O2S and a molecular weight of 266.28 g/mol. Its IUPAC name is 1-methyl-4-(4,4,4-trifluorobutylsulfonyl)benzene.
| Compound Name | 1-methyl-4-(4,4,4-trifluorobutylsulfonyl)benzene |
|---|---|
| PubChem CID | 129132136 |
| Molecular Formula | C11H13F3O2S |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 1-methyl-4-(4,4,4-trifluorobutylsulfonyl)benzene |
| SMILES | Cc1ccc(S(=O)(=O)CCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H13F3O2S/c1-9-3-5-10(6-4-9)17(15,16)8-2-7-11(12,13)14/h3-6H,2,7-8H2,1H3 |
| InChIKey | YSVFJZVGOHSVNY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |