C14H21F2NO2S — CID 54114620
2,2-difluoro-N-[3-(4-methylphenyl)sulfonylpropyl]butan-1-amine (PubChem CID 54114620) has the molecular formula C14H21F2NO2S and a molecular weight of 305.39 g/mol. Its IUPAC name is 2,2-difluoro-N-[3-(4-methylphenyl)sulfonylpropyl]butan-1-amine.
| Compound Name | 2,2-difluoro-N-[3-(4-methylphenyl)sulfonylpropyl]butan-1-amine |
|---|---|
| PubChem CID | 54114620 |
| Molecular Formula | C14H21F2NO2S |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2,2-difluoro-N-[3-(4-methylphenyl)sulfonylpropyl]butan-1-amine |
| SMILES | CCC(F)(F)CNCCCS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H21F2NO2S/c1-3-14(15,16)11-17-9-4-10-20(18,19)13-7-5-12(2)6-8-13/h5-8,17H,3-4,9-11H2,1-2H3 |
| InChIKey | NJMDRENAGZFSDM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|