C14H17F3O2S — CID 162047256
1-methyl-4-[(E)-7,7,7-trifluorohept-4-enyl]sulfonylbenzene (PubChem CID 162047256) has the molecular formula C14H17F3O2S and a molecular weight of 306.35 g/mol. Its IUPAC name is 1-methyl-4-[(E)-7,7,7-trifluorohept-4-enyl]sulfonylbenzene.
| Compound Name | 1-methyl-4-[(E)-7,7,7-trifluorohept-4-enyl]sulfonylbenzene |
|---|---|
| PubChem CID | 162047256 |
| Molecular Formula | C14H17F3O2S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 1-methyl-4-[(E)-7,7,7-trifluorohept-4-enyl]sulfonylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)CCC/C=C/CC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3O2S/c1-12-6-8-13(9-7-12)20(18,19)11-5-3-2-4-10-14(15,16)17/h2,4,6-9H,3,5,10-11H2,1H3/b4-2+ |
| InChIKey | NHSVDCFLZGLRNJ-DUXPYHPUSA-N |
| XLogP | 4.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|