C13H15F3 — CID 139667131
1-methyl-4-(6,6,6-trifluorohex-3-enyl)benzene (PubChem CID 139667131) has the molecular formula C13H15F3 and a molecular weight of 228.26 g/mol. Its IUPAC name is 1-methyl-4-(6,6,6-trifluorohex-3-enyl)benzene.
| Compound Name | 1-methyl-4-(6,6,6-trifluorohex-3-enyl)benzene |
|---|---|
| PubChem CID | 139667131 |
| Molecular Formula | C13H15F3 |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 1-methyl-4-(6,6,6-trifluorohex-3-enyl)benzene |
| SMILES | Cc1ccc(CCC=CCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3/c1-11-6-8-12(9-7-11)5-3-2-4-10-13(14,15)16/h2,4,6-9H,3,5,10H2,1H3 |
| InChIKey | NHURKFYWBOLEDR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|