C16H20F2O5S — CID 122366207
ethyl (E)-2,2-difluoro-7-(4-methylphenyl)sulfonyloxyhept-4-enoate (PubChem CID 122366207) has the molecular formula C16H20F2O5S and a molecular weight of 362.39 g/mol. Its IUPAC name is ethyl (E)-2,2-difluoro-7-(4-methylphenyl)sulfonyloxyhept-4-enoate.
| Compound Name | ethyl (E)-2,2-difluoro-7-(4-methylphenyl)sulfonyloxyhept-4-enoate |
|---|---|
| PubChem CID | 122366207 |
| Molecular Formula | C16H20F2O5S |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | ethyl (E)-2,2-difluoro-7-(4-methylphenyl)sulfonyloxyhept-4-enoate |
| SMILES | CCOC(=O)C(F)(F)C/C=C/CCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H20F2O5S/c1-3-22-15(19)16(17,18)11-5-4-6-12-23-24(20,21)14-9-7-13(2)8-10-14/h4-5,7-10H,3,6,11-12H2,1-2H3/b5-4+ |
| InChIKey | YSQUTFWZJPJLJX-SNAWJCMRSA-N |
| XLogP | 3.24 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|