C25H38O3S — CID 14189671
[(9Z,12Z,15Z)-octadeca-9,12,15-trienyl] 4-methylbenzenesulfonate (PubChem CID 14189671) has the molecular formula C25H38O3S and a molecular weight of 418.64 g/mol. Its IUPAC name is [(9Z,12Z,15Z)-octadeca-9,12,15-trienyl] 4-methylbenzenesulfonate.
| Compound Name | [(9Z,12Z,15Z)-octadeca-9,12,15-trienyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 14189671 |
| Molecular Formula | C25H38O3S |
| Molecular Weight | 418.64 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | [(9Z,12Z,15Z)-octadeca-9,12,15-trienyl] 4-methylbenzenesulfonate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H38O3S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-28-29(26,27)25-21-19-24(2)20-22-25/h4-5,7-8,10-11,19-22H,3,6,9,12-18,23H2,1-2H3/b5-4-,8-7-,11-10- |
| InChIKey | ISQZELMRBKAGBV-YSTUJMKBSA-N |
| XLogP | 7.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.64 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|