C28H40O5S — CID 85129707
methyl 20-(4-methylphenyl)sulfonyloxyicosa-5,8,11,14-tetraenoate (PubChem CID 85129707) has the molecular formula C28H40O5S and a molecular weight of 488.69 g/mol. Its IUPAC name is methyl 20-(4-methylphenyl)sulfonyloxyicosa-5,8,11,14-tetraenoate.
| Compound Name | methyl 20-(4-methylphenyl)sulfonyloxyicosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 85129707 |
| Molecular Formula | C28H40O5S |
| Molecular Weight | 488.69 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | methyl 20-(4-methylphenyl)sulfonyloxyicosa-5,8,11,14-tetraenoate |
| SMILES | COC(=O)CCCC=CCC=CCC=CCC=CCCCCCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H40O5S/c1-26-21-23-27(24-22-26)34(30,31)33-25-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-28(29)32-2/h3,5-6,8-9,11-12,14,21-24H,4,7,10,13,15-20,25H2,1-2H3 |
| InChIKey | NNAXWRJPIXJAKQ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.69 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|