C28H42O7S — CID 10346674
methyl (5Z,8Z,10S,11S,12R,14Z)-10,11-dihydroxy-12-(4-methylphenyl)sulfonyloxyicosa-5,8,14-trienoate (PubChem CID 10346674) has the molecular formula C28H42O7S and a molecular weight of 522.70 g/mol. Its IUPAC name is methyl (5Z,8Z,10S,11S,12R,14Z)-10,11-dihydroxy-12-(4-methylphenyl)sulfonyloxyicosa-5,8,14-trienoate.
| Compound Name | methyl (5Z,8Z,10S,11S,12R,14Z)-10,11-dihydroxy-12-(4-methylphenyl)sulfonyloxyicosa-5,8,14-trienoate |
|---|---|
| PubChem CID | 10346674 |
| Molecular Formula | C28H42O7S |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | methyl (5Z,8Z,10S,11S,12R,14Z)-10,11-dihydroxy-12-(4-methylphenyl)sulfonyloxyicosa-5,8,14-trienoate |
| SMILES | CCCCC/C=C\C[C@@H](OS(=O)(=O)c1ccc(C)cc1)[C@@H](O)[C@@H](O)/C=C\C/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C28H42O7S/c1-4-5-6-7-11-14-17-26(35-36(32,33)24-21-19-23(2)20-22-24)28(31)25(29)16-13-10-8-9-12-15-18-27(30)34-3/h8-9,11,13-14,16,19-22,25-26,28-29,31H,4-7,10,12,15,17-18H2,1-3H3/b9-8-,14-11-,16-13-/t25-,26+,28-/m0/s1 |
| InChIKey | YFZXICYYRCLHIK-VGRYXGEGSA-N |
| XLogP | 5.16 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|