C25H42O4S — CID 90871798
(E)-non-4-en-1-ol;[(E)-non-4-enyl] 4-methylbenzenesulfonate (PubChem CID 90871798) has the molecular formula C25H42O4S and a molecular weight of 438.67 g/mol. Its IUPAC name is (E)-non-4-en-1-ol;[(E)-non-4-enyl] 4-methylbenzenesulfonate.
| Compound Name | (E)-non-4-en-1-ol;[(E)-non-4-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 90871798 |
| Molecular Formula | C25H42O4S |
| Molecular Weight | 438.67 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | (E)-non-4-en-1-ol;[(E)-non-4-enyl] 4-methylbenzenesulfonate |
| SMILES | CCCC/C=C/CCCO.CCCC/C=C/CCCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H24O3S.C9H18O/c1-3-4-5-6-7-8-9-14-19-20(17,18)16-12-10-15(2)11-13-16;1-2-3-4-5-6-7-8-9-10/h6-7,10-13H,3-5,8-9,14H2,1-2H3;5-6,10H,2-4,7-9H2,1H3/b7-6+;6-5+ |
| InChIKey | OWPSBDHWMVNNOD-MAVWREHFSA-N |
| XLogP | 6.73 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.67 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|