C40H45O5PS — CID 10723113
[(3Z,6Z,9Z)-14-methoxy-14-oxotetradeca-3,6,9-trienyl]-triphenylphosphanium;4-methylbenzenesulfonate (PubChem CID 10723113) has the molecular formula C40H45O5PS and a molecular weight of 668.84 g/mol. Its IUPAC name is [(3Z,6Z,9Z)-14-methoxy-14-oxotetradeca-3,6,9-trienyl]-triphenylphosphanium;4-methylbenzenesulfonate.
| Compound Name | [(3Z,6Z,9Z)-14-methoxy-14-oxotetradeca-3,6,9-trienyl]-triphenylphosphanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10723113 |
| Molecular Formula | C40H45O5PS |
| Molecular Weight | 668.84 g/mol |
| Exact Mass | 668.27 |
| IUPAC Name | [(3Z,6Z,9Z)-14-methoxy-14-oxotetradeca-3,6,9-trienyl]-triphenylphosphanium;4-methylbenzenesulfonate |
| SMILES | COC(=O)CCC/C=C\C/C=C\C/C=C\CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C33H38O2P.C7H8O3S/c1-35-33(34)28-20-9-7-5-3-2-4-6-8-10-21-29-36(30-22-14-11-15-23-30,31-24-16-12-17-25-31)32-26-18-13-19-27-32;1-6-2-4-7(5-3-6)11(8,9)10/h2,4-5,7-8,10-19,22-27H,3,6,9,20-21,28-29H2,1H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1/b4-2-,7-5-,10-8-; |
| InChIKey | CDNMFBDDSMZWJG-AGNMJYADSA-M |
| XLogP | 8.06 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.84 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|