About sodium;3-[(2-methoxy-2-oxoethyl)-diphenylphosphaniumyl]benzenesulfonate;hydrobromide
sodium;3-[(2-methoxy-2-oxoethyl)-diphenylphosphaniumyl]benzenesulfonate;hydrobromide (PubChem CID 158929034) has the molecular formula C21H20BrNaO5PS+
and a molecular weight of 518.32 g/mol. Its IUPAC name is sodium;3-[(2-methoxy-2-oxoethyl)-diphenylphosphaniumyl]benzenesulfonate;hydrobromide.
Molecular Properties
| Compound Name | sodium;3-[(2-methoxy-2-oxoethyl)-diphenylphosphaniumyl]benzenesulfonate;hydrobromide |
| PubChem CID | 158929034 |
| Molecular Formula | C21H20BrNaO5PS+ |
| Molecular Weight | 518.32 g/mol |
| Exact Mass | 516.98 |
| IUPAC Name | sodium;3-[(2-methoxy-2-oxoethyl)-diphenylphosphaniumyl]benzenesulfonate;hydrobromide |
| SMILES | Br.COC(=O)C[P+](c1ccccc1)(c1ccccc1)c1cccc(S(=O)(=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C21H19O5PS.BrH.Na/c1-26-21(22)16-27(17-9-4-2-5-10-17,18-11-6-3-7-12-18)19-13-8-14-20(15-19)28(23,24)25;;/h2-15H,16H2,1H3;1H;/q;;+1 |
| InChIKey | RTYMEPJNLWTSCD-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 518.32 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;3-[(2-methoxy-2-oxoethyl)-diphenylphosphaniumyl]benzenesulfonate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3-[(2-methoxy-2-oxoethyl)-diphenylphosphaniumyl]benzenesulfonate;hydrobromide?
The IUPAC name of sodium;3-[(2-methoxy-2-oxoethyl)-diphenylphosphaniumyl]benzenesulfonate;hydrobromide (CID 158929034) is sodium;3-[(2-methoxy-2-oxoethyl)-diphenylphosphaniumyl]benzenesulfonate;hydrobromide.
What is the SMILES notation for sodium;3-[(2-methoxy-2-oxoethyl)-diphenylphosphaniumyl]benzenesulfonate;hydrobromide?
The canonical SMILES for sodium;3-[(2-methoxy-2-oxoethyl)-diphenylphosphaniumyl]benzenesulfonate;hydrobromide is Br.COC(=O)C[P+](c1ccccc1)(c1ccccc1)c1cccc(S(=O)(=O)[O-])c1.[Na+].
What is the InChIKey of sodium;3-[(2-methoxy-2-oxoethyl)-diphenylphosphaniumyl]benzenesulfonate;hydrobromide?
The InChIKey is RTYMEPJNLWTSCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19O5PS.BrH.Na/c1-26-21(22)16-27(17-9-4-2-5-10-17,18-11-6-3-7-12-18)19-13-8-14-20(15-19)28(23,24)25;;/h2-15H,16H2,1H3;1H;/q;;+1.
What are the key properties of sodium;3-[(2-methoxy-2-oxoethyl)-diphenylphosphaniumyl]benzenesulfonate;hydrobromide?
sodium;3-[(2-methoxy-2-oxoethyl)-diphenylphosphaniumyl]benzenesulfonate;hydrobromide has a molecular weight of 518.32 g/mol, XLogP of -0.36, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3-[(2-methoxy-2-oxoethyl)-diphenylphosphaniumyl]benzenesulfonate;hydrobromide is sourced from PubChem (CID 158929034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).