C39H33O7PS — CID 157102760
benzene-1,3-dicarboxylic acid;benzenesulfonate;benzyl(triphenyl)phosphanium (PubChem CID 157102760) has the molecular formula C39H33O7PS and a molecular weight of 676.73 g/mol. Its IUPAC name is benzene-1,3-dicarboxylic acid;benzenesulfonate;benzyl(triphenyl)phosphanium.
| Compound Name | benzene-1,3-dicarboxylic acid;benzenesulfonate;benzyl(triphenyl)phosphanium |
|---|---|
| PubChem CID | 157102760 |
| Molecular Formula | C39H33O7PS |
| Molecular Weight | 676.73 g/mol |
| Exact Mass | 676.17 |
| IUPAC Name | benzene-1,3-dicarboxylic acid;benzenesulfonate;benzyl(triphenyl)phosphanium |
| SMILES | O=C(O)c1cccc(C(=O)O)c1.O=S(=O)([O-])c1ccccc1.c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22P.C8H6O4.C6H6O3S/c1-5-13-22(14-6-1)21-26(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25;9-7(10)5-2-1-3-6(4-5)8(11)12;7-10(8,9)6-4-2-1-3-5-6/h1-20H,21H2;1-4H,(H,9,10)(H,11,12);1-5H,(H,7,8,9)/q+1;;/p-1 |
| InChIKey | AFYKAHWDOQAUGH-UHFFFAOYSA-M |
| XLogP | 6.85 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.73 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|