C40H45O4PS — CID 22416421
3,5-ditert-butyl-4-hydroxybenzenesulfonate;(4-methylphenyl)methyl-triphenylphosphanium (PubChem CID 22416421) has the molecular formula C40H45O4PS and a molecular weight of 652.84 g/mol. Its IUPAC name is 3,5-ditert-butyl-4-hydroxybenzenesulfonate;(4-methylphenyl)methyl-triphenylphosphanium.
| Compound Name | 3,5-ditert-butyl-4-hydroxybenzenesulfonate;(4-methylphenyl)methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 22416421 |
| Molecular Formula | C40H45O4PS |
| Molecular Weight | 652.84 g/mol |
| Exact Mass | 652.28 |
| IUPAC Name | 3,5-ditert-butyl-4-hydroxybenzenesulfonate;(4-methylphenyl)methyl-triphenylphosphanium |
| SMILES | CC(C)(C)c1cc(S(=O)(=O)[O-])cc(C(C)(C)C)c1O.Cc1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H24P.C14H22O4S/c1-22-17-19-23(20-18-22)21-27(24-11-5-2-6-12-24,25-13-7-3-8-14-25)26-15-9-4-10-16-26;1-13(2,3)10-7-9(19(16,17)18)8-11(12(10)15)14(4,5)6/h2-20H,21H2,1H3;7-8,15H,1-6H3,(H,16,17,18)/q+1;/p-1 |
| InChIKey | QHPFZSKYQBFNAN-UHFFFAOYSA-M |
| XLogP | 8.38 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.84 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|