C36H30O2P+ — CID 5195137
(9,10-dioxoanthracen-2-yl)methyl-tris(4-methylphenyl)phosphanium (PubChem CID 5195137) has the molecular formula C36H30O2P+ and a molecular weight of 525.61 g/mol. Its IUPAC name is (9,10-dioxoanthracen-2-yl)methyl-tris(4-methylphenyl)phosphanium.
| Compound Name | (9,10-dioxoanthracen-2-yl)methyl-tris(4-methylphenyl)phosphanium |
|---|---|
| PubChem CID | 5195137 |
| Molecular Formula | C36H30O2P+ |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | (9,10-dioxoanthracen-2-yl)methyl-tris(4-methylphenyl)phosphanium |
| SMILES | Cc1ccc([P+](Cc2ccc3c(c2)C(=O)c2ccccc2C3=O)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C36H30O2P/c1-24-8-15-28(16-9-24)39(29-17-10-25(2)11-18-29,30-19-12-26(3)13-20-30)23-27-14-21-33-34(22-27)36(38)32-7-5-4-6-31(32)35(33)37/h4-22H,23H2,1-3H3/q+1 |
| InChIKey | PVKBJHQLAJTWRS-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|