C38H36O4 — CID 69114392
2-ethylanthracene-9,10-dione;1,2,3,4,5,6,7,8-octamethylanthracene-9,10-dione (PubChem CID 69114392) has the molecular formula C38H36O4 and a molecular weight of 556.70 g/mol. Its IUPAC name is 2-ethylanthracene-9,10-dione;1,2,3,4,5,6,7,8-octamethylanthracene-9,10-dione.
| Compound Name | 2-ethylanthracene-9,10-dione;1,2,3,4,5,6,7,8-octamethylanthracene-9,10-dione |
|---|---|
| PubChem CID | 69114392 |
| Molecular Formula | C38H36O4 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | 2-ethylanthracene-9,10-dione;1,2,3,4,5,6,7,8-octamethylanthracene-9,10-dione |
| SMILES | CCc1ccc2c(c1)C(=O)c1ccccc1C2=O.Cc1c(C)c(C)c2c(c1C)C(=O)c1c(C)c(C)c(C)c(C)c1C2=O |
| InChI | InChI=1S/C22H24O2.C16H12O2/c1-9-10(2)14(6)18-17(13(9)5)21(23)19-15(7)11(3)12(4)16(8)20(19)22(18)24;1-2-10-7-8-13-14(9-10)16(18)12-6-4-3-5-11(12)15(13)17/h1-8H3;3-9H,2H2,1H3 |
| InChIKey | RRNYGIVPXYWMCA-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|