C23H16O2 — CID 15152091
2-[(Z)-2-(4-methylphenyl)ethenyl]anthracene-9,10-dione (PubChem CID 15152091) has the molecular formula C23H16O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-[(Z)-2-(4-methylphenyl)ethenyl]anthracene-9,10-dione.
| Compound Name | 2-[(Z)-2-(4-methylphenyl)ethenyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 15152091 |
| Molecular Formula | C23H16O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 2-[(Z)-2-(4-methylphenyl)ethenyl]anthracene-9,10-dione |
| SMILES | Cc1ccc(/C=C\c2ccc3c(c2)C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C23H16O2/c1-15-6-8-16(9-7-15)10-11-17-12-13-20-21(14-17)23(25)19-5-3-2-4-18(19)22(20)24/h2-14H,1H3/b11-10- |
| InChIKey | LWOCTTIAWWZDDI-KHPPLWFESA-N |
| XLogP | 4.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|