C22H14O3 — CID 175395708
2-[2-(2-hydroxyphenyl)ethenyl]anthracene-9,10-dione (PubChem CID 175395708) has the molecular formula C22H14O3 and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-[2-(2-hydroxyphenyl)ethenyl]anthracene-9,10-dione.
| Compound Name | 2-[2-(2-hydroxyphenyl)ethenyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 175395708 |
| Molecular Formula | C22H14O3 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-[2-(2-hydroxyphenyl)ethenyl]anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2cc(C=Cc3ccccc3O)ccc21 |
| InChI | InChI=1S/C22H14O3/c23-20-8-4-1-5-15(20)11-9-14-10-12-18-19(13-14)22(25)17-7-3-2-6-16(17)21(18)24/h1-13,23H |
| InChIKey | DQMJXTNZDZNCFD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|