C22H12N2O6 — CID 2749492
2-[2-(2,4-dinitrophenyl)ethenyl]anthracene-9,10-dione (PubChem CID 2749492) has the molecular formula C22H12N2O6 and a molecular weight of 400.35 g/mol. Its IUPAC name is 2-[2-(2,4-dinitrophenyl)ethenyl]anthracene-9,10-dione.
| Compound Name | 2-[2-(2,4-dinitrophenyl)ethenyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 2749492 |
| Molecular Formula | C22H12N2O6 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 2-[2-(2,4-dinitrophenyl)ethenyl]anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2cc(C=Cc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C22H12N2O6/c25-21-16-3-1-2-4-17(16)22(26)19-11-13(6-10-18(19)21)5-7-14-8-9-15(23(27)28)12-20(14)24(29)30/h1-12H |
| InChIKey | ZYMZMQNVLAXBRF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|