C30H18N2O6 — CID 71408520
1,5-bis[2-(4-nitrophenyl)ethenyl]anthracene-9,10-dione (PubChem CID 71408520) has the molecular formula C30H18N2O6 and a molecular weight of 502.48 g/mol. Its IUPAC name is 1,5-bis[2-(4-nitrophenyl)ethenyl]anthracene-9,10-dione.
| Compound Name | 1,5-bis[2-(4-nitrophenyl)ethenyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 71408520 |
| Molecular Formula | C30H18N2O6 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 1,5-bis[2-(4-nitrophenyl)ethenyl]anthracene-9,10-dione |
| SMILES | O=C1c2cccc(C=Cc3ccc([N+](=O)[O-])cc3)c2C(=O)c2cccc(C=Cc3ccc([N+](=O)[O-])cc3)c21 |
| InChI | InChI=1S/C30H18N2O6/c33-29-25-5-1-3-21(13-7-19-9-15-23(16-10-19)31(35)36)27(25)30(34)26-6-2-4-22(28(26)29)14-8-20-11-17-24(18-12-20)32(37)38/h1-18H |
| InChIKey | ZKPKYADDXOCTDH-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|