C42H31NO2 — CID 122387900
1-[(E)-2-(4-nitrophenyl)ethenyl]-4-[(E)-2-[4-(1,2,2-triphenylethenyl)phenyl]ethenyl]benzene (PubChem CID 122387900) has the molecular formula C42H31NO2 and a molecular weight of 581.72 g/mol. Its IUPAC name is 1-[(E)-2-(4-nitrophenyl)ethenyl]-4-[(E)-2-[4-(1,2,2-triphenylethenyl)phenyl]ethenyl]benzene.
| Compound Name | 1-[(E)-2-(4-nitrophenyl)ethenyl]-4-[(E)-2-[4-(1,2,2-triphenylethenyl)phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 122387900 |
| Molecular Formula | C42H31NO2 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | 1-[(E)-2-(4-nitrophenyl)ethenyl]-4-[(E)-2-[4-(1,2,2-triphenylethenyl)phenyl]ethenyl]benzene |
| SMILES | O=[N+]([O-])c1ccc(/C=C/c2ccc(/C=C/c3ccc(C(=C(c4ccccc4)c4ccccc4)c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C42H31NO2/c44-43(45)40-30-26-35(27-31-40)23-21-33-18-16-32(17-19-33)20-22-34-24-28-39(29-25-34)42(38-14-8-3-9-15-38)41(36-10-4-1-5-11-36)37-12-6-2-7-13-37/h1-31H/b22-20+,23-21+ |
| InChIKey | CHHPHMNSALGHPZ-DQPVQCHKSA-N |
| XLogP | 10.94 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|