C54H38N2O4 — CID 59100524
2,3-bis[2-[4-[2-(4-nitrophenyl)-2-phenylethenyl]phenyl]ethenyl]naphthalene (PubChem CID 59100524) has the molecular formula C54H38N2O4 and a molecular weight of 778.91 g/mol. Its IUPAC name is 2,3-bis[2-[4-[2-(4-nitrophenyl)-2-phenylethenyl]phenyl]ethenyl]naphthalene.
| Compound Name | 2,3-bis[2-[4-[2-(4-nitrophenyl)-2-phenylethenyl]phenyl]ethenyl]naphthalene |
|---|---|
| PubChem CID | 59100524 |
| Molecular Formula | C54H38N2O4 |
| Molecular Weight | 778.91 g/mol |
| Exact Mass | 778.28 |
| IUPAC Name | 2,3-bis[2-[4-[2-(4-nitrophenyl)-2-phenylethenyl]phenyl]ethenyl]naphthalene |
| SMILES | O=[N+]([O-])c1ccc(C(=Cc2ccc(C=Cc3cc4ccccc4cc3C=Cc3ccc(C=C(c4ccccc4)c4ccc([N+](=O)[O-])cc4)cc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C54H38N2O4/c57-55(58)51-31-27-45(28-32-51)53(43-9-3-1-4-10-43)35-41-19-15-39(16-20-41)23-25-49-37-47-13-7-8-14-48(47)38-50(49)26-24-40-17-21-42(22-18-40)36-54(44-11-5-2-6-12-44)46-29-33-52(34-30-46)56(59)60/h1-38H |
| InChIKey | PQIDGFTXVJNZPL-UHFFFAOYSA-N |
| XLogP | 14.17 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.91 |
| LogP ≤ 5 | 14.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|