C16H15N3O4 — CID 92907800
4-[(Z)-2-(2,4-dinitrophenyl)ethenyl]-N,N-dimethylaniline (PubChem CID 92907800) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is 4-[(Z)-2-(2,4-dinitrophenyl)ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(Z)-2-(2,4-dinitrophenyl)ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 92907800 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 4-[(Z)-2-(2,4-dinitrophenyl)ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C\c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H15N3O4/c1-17(2)14-8-4-12(5-9-14)3-6-13-7-10-15(18(20)21)11-16(13)19(22)23/h3-11H,1-2H3/b6-3- |
| InChIKey | FUQVXPNRYJFXSG-UTCJRWHESA-N |
| XLogP | 3.74 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|