C8H5BrN2O4 — CID 73297332
1-(2-bromoethenyl)-2,4-dinitrobenzene (PubChem CID 73297332) has the molecular formula C8H5BrN2O4 and a molecular weight of 273.04 g/mol. Its IUPAC name is 1-(2-bromoethenyl)-2,4-dinitrobenzene.
| Compound Name | 1-(2-bromoethenyl)-2,4-dinitrobenzene |
|---|---|
| PubChem CID | 73297332 |
| Molecular Formula | C8H5BrN2O4 |
| Molecular Weight | 273.04 g/mol |
| Exact Mass | 271.94 |
| IUPAC Name | 1-(2-bromoethenyl)-2,4-dinitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(C=CBr)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H5BrN2O4/c9-4-3-6-1-2-7(10(12)13)5-8(6)11(14)15/h1-5H |
| InChIKey | LQZLEBYCPGQHBQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.04 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|