C12H9N3O4 — CID 101222114
(2E)-2-[(2,4-dinitrophenyl)methylidene]-1H-pyridine (PubChem CID 101222114) has the molecular formula C12H9N3O4 and a molecular weight of 259.22 g/mol. Its IUPAC name is (2E)-2-[(2,4-dinitrophenyl)methylidene]-1H-pyridine.
| Compound Name | (2E)-2-[(2,4-dinitrophenyl)methylidene]-1H-pyridine |
|---|---|
| PubChem CID | 101222114 |
| Molecular Formula | C12H9N3O4 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | (2E)-2-[(2,4-dinitrophenyl)methylidene]-1H-pyridine |
| SMILES | O=[N+]([O-])c1ccc(/C=C2\C=CC=CN2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H9N3O4/c16-14(17)11-5-4-9(12(8-11)15(18)19)7-10-3-1-2-6-13-10/h1-8,13H/b10-7+ |
| InChIKey | IGTYXPNPCNNHAH-JXMROGBWSA-N |
| XLogP | 2.52 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|