C38H28N8O8 — CID 139085698
N-[(E)-(2,4-dinitrophenyl)methylideneamino]-N-phenylaniline (PubChem CID 139085698) has the molecular formula C38H28N8O8 and a molecular weight of 724.69 g/mol. Its IUPAC name is N-[(E)-(2,4-dinitrophenyl)methylideneamino]-N-phenylaniline.
| Compound Name | N-[(E)-(2,4-dinitrophenyl)methylideneamino]-N-phenylaniline |
|---|---|
| PubChem CID | 139085698 |
| Molecular Formula | C38H28N8O8 |
| Molecular Weight | 724.69 g/mol |
| Exact Mass | 724.20 |
| IUPAC Name | N-[(E)-(2,4-dinitrophenyl)methylideneamino]-N-phenylaniline |
| SMILES | O=[N+]([O-])c1ccc(/C=N/N(c2ccccc2)c2ccccc2)c([N+](=O)[O-])c1.O=[N+]([O-])c1ccc(/C=N/N(c2ccccc2)c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/2C19H14N4O4/c2*24-22(25)18-12-11-15(19(13-18)23(26)27)14-20-21(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h2*1-14H/b2*20-14+ |
| InChIKey | HSABISRYTPRQOW-NYTNQUJYSA-N |
| XLogP | 9.35 |
| TPSA | 203.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.69 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|