C15H14N4O5 — CID 135717215
2-[(E)-[(2,4-dinitrophenyl)-ethylhydrazinylidene]methyl]phenol (PubChem CID 135717215) has the molecular formula C15H14N4O5 and a molecular weight of 330.30 g/mol. Its IUPAC name is 2-[(E)-[(2,4-dinitrophenyl)-ethylhydrazinylidene]methyl]phenol.
| Compound Name | 2-[(E)-[(2,4-dinitrophenyl)-ethylhydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135717215 |
| Molecular Formula | C15H14N4O5 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-[(E)-[(2,4-dinitrophenyl)-ethylhydrazinylidene]methyl]phenol |
| SMILES | CCN(/N=C/c1ccccc1O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H14N4O5/c1-2-17(16-10-11-5-3-4-6-15(11)20)13-8-7-12(18(21)22)9-14(13)19(23)24/h3-10,20H,2H2,1H3/b16-10+ |
| InChIKey | DETGUPQDNYIYDH-MHWRWJLKSA-N |
| XLogP | 3.07 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|