C13H9N3O5 — CID 102417808
2-[(2,4-dinitrophenyl)methylideneamino]phenol (PubChem CID 102417808) has the molecular formula C13H9N3O5 and a molecular weight of 287.23 g/mol. Its IUPAC name is 2-[(2,4-dinitrophenyl)methylideneamino]phenol.
| Compound Name | 2-[(2,4-dinitrophenyl)methylideneamino]phenol |
|---|---|
| PubChem CID | 102417808 |
| Molecular Formula | C13H9N3O5 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 2-[(2,4-dinitrophenyl)methylideneamino]phenol |
| SMILES | O=[N+]([O-])c1ccc(/C=N/c2ccccc2O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H9N3O5/c17-13-4-2-1-3-11(13)14-8-9-5-6-10(15(18)19)7-12(9)16(20)21/h1-8,17H/b14-8+ |
| InChIKey | HQKVDBIMZIQWEF-RIYZIHGNSA-N |
| XLogP | 2.96 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|