C32H30N4O10 — CID 3429758
2-[[2-[2-[2-[2-[2-[(2-hydroxy-5-nitrophenyl)methylideneamino]phenoxy]ethoxy]ethoxy]ethoxy]phenyl]iminomethyl]-4-nitrophenol (PubChem CID 3429758) has the molecular formula C32H30N4O10 and a molecular weight of 630.61 g/mol. Its IUPAC name is 2-[[2-[2-[2-[2-[2-[(2-hydroxy-5-nitrophenyl)methylideneamino]phenoxy]ethoxy]ethoxy]ethoxy]phenyl]iminomethyl]-4-nitrophenol.
| Compound Name | 2-[[2-[2-[2-[2-[2-[(2-hydroxy-5-nitrophenyl)methylideneamino]phenoxy]ethoxy]ethoxy]ethoxy]phenyl]iminomethyl]-4-nitrophenol |
|---|---|
| PubChem CID | 3429758 |
| Molecular Formula | C32H30N4O10 |
| Molecular Weight | 630.61 g/mol |
| Exact Mass | 630.20 |
| IUPAC Name | 2-[[2-[2-[2-[2-[2-[(2-hydroxy-5-nitrophenyl)methylideneamino]phenoxy]ethoxy]ethoxy]ethoxy]phenyl]iminomethyl]-4-nitrophenol |
| SMILES | O=[N+]([O-])c1ccc(O)c(/C=N/c2ccccc2OCCOCCOCCOc2ccccc2/N=C/c2cc([N+](=O)[O-])ccc2O)c1 |
| InChI | InChI=1S/C32H30N4O10/c37-29-11-9-25(35(39)40)19-23(29)21-33-27-5-1-3-7-31(27)45-17-15-43-13-14-44-16-18-46-32-8-4-2-6-28(32)34-22-24-20-26(36(41)42)10-12-30(24)38/h1-12,19-22,37-38H,13-18H2/b33-21+,34-22+ |
| InChIKey | ZTYAPKGRZQIRPO-WXGDAXOSSA-N |
| XLogP | 5.91 |
| TPSA | 188.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.61 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|