C32H28N4O10-2 — CID 7072618
4-nitro-2-[[2-[2-[2-[2-[2-[(5-nitro-2-oxidophenyl)methylideneamino]phenoxy]ethoxy]ethoxy]ethoxy]phenyl]iminomethyl]phenolate (PubChem CID 7072618) has the molecular formula C32H28N4O10-2 and a molecular weight of 628.59 g/mol. Its IUPAC name is 4-nitro-2-[[2-[2-[2-[2-[2-[(5-nitro-2-oxidophenyl)methylideneamino]phenoxy]ethoxy]ethoxy]ethoxy]phenyl]iminomethyl]phenolate.
| Compound Name | 4-nitro-2-[[2-[2-[2-[2-[2-[(5-nitro-2-oxidophenyl)methylideneamino]phenoxy]ethoxy]ethoxy]ethoxy]phenyl]iminomethyl]phenolate |
|---|---|
| PubChem CID | 7072618 |
| Molecular Formula | C32H28N4O10-2 |
| Molecular Weight | 628.59 g/mol |
| Exact Mass | 628.18 |
| IUPAC Name | 4-nitro-2-[[2-[2-[2-[2-[2-[(5-nitro-2-oxidophenyl)methylideneamino]phenoxy]ethoxy]ethoxy]ethoxy]phenyl]iminomethyl]phenolate |
| SMILES | O=[N+]([O-])c1ccc([O-])c(/C=N/c2ccccc2OCCOCCOCCOc2ccccc2/N=C/c2cc([N+](=O)[O-])ccc2[O-])c1 |
| InChI | InChI=1S/C32H30N4O10/c37-29-11-9-25(35(39)40)19-23(29)21-33-27-5-1-3-7-31(27)45-17-15-43-13-14-44-16-18-46-32-8-4-2-6-28(32)34-22-24-20-26(36(41)42)10-12-30(24)38/h1-12,19-22,37-38H,13-18H2/p-2/b33-21+,34-22+ |
| InChIKey | ZTYAPKGRZQIRPO-WXGDAXOSSA-L |
| XLogP | 4.64 |
| TPSA | 194.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|