C17H10F5N3O4 — CID 11154230
1-(2,4-dinitrophenyl)-N-[(Z)-3,3,4,4,4-pentafluoro-1-phenylbut-1-en-2-yl]methanimine (PubChem CID 11154230) has the molecular formula C17H10F5N3O4 and a molecular weight of 415.27 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)-N-[(Z)-3,3,4,4,4-pentafluoro-1-phenylbut-1-en-2-yl]methanimine.
| Compound Name | 1-(2,4-dinitrophenyl)-N-[(Z)-3,3,4,4,4-pentafluoro-1-phenylbut-1-en-2-yl]methanimine |
|---|---|
| PubChem CID | 11154230 |
| Molecular Formula | C17H10F5N3O4 |
| Molecular Weight | 415.27 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 1-(2,4-dinitrophenyl)-N-[(Z)-3,3,4,4,4-pentafluoro-1-phenylbut-1-en-2-yl]methanimine |
| SMILES | O=[N+]([O-])c1ccc(/C=N/C(=C\c2ccccc2)C(F)(F)C(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H10F5N3O4/c18-16(19,17(20,21)22)15(8-11-4-2-1-3-5-11)23-10-12-6-7-13(24(26)27)9-14(12)25(28)29/h1-10H/b15-8-,23-10+ |
| InChIKey | DAZQQNLKUXARPP-WTRRTPMQSA-N |
| XLogP | 5.16 |
| TPSA | 98.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.27 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|