C21H14N6O8 — CID 126004226
N-[(Z)-(2,4-dinitrophenyl)methylideneamino]-2-[(4-nitrobenzoyl)amino]benzamide (PubChem CID 126004226) has the molecular formula C21H14N6O8 and a molecular weight of 478.38 g/mol. Its IUPAC name is N-[(Z)-(2,4-dinitrophenyl)methylideneamino]-2-[(4-nitrobenzoyl)amino]benzamide.
| Compound Name | N-[(Z)-(2,4-dinitrophenyl)methylideneamino]-2-[(4-nitrobenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 126004226 |
| Molecular Formula | C21H14N6O8 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | N-[(Z)-(2,4-dinitrophenyl)methylideneamino]-2-[(4-nitrobenzoyl)amino]benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)N/N=C\c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H14N6O8/c28-20(13-5-8-15(9-6-13)25(30)31)23-18-4-2-1-3-17(18)21(29)24-22-12-14-7-10-16(26(32)33)11-19(14)27(34)35/h1-12H,(H,23,28)(H,24,29)/b22-12- |
| InChIKey | NNEBBCMTAGTSHC-UUYOSTAYSA-N |
| XLogP | 3.43 |
| TPSA | 199.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|