C22H17N5O8 — CID 135715855
N-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-2-[(4-methoxybenzoyl)amino]benzamide (PubChem CID 135715855) has the molecular formula C22H17N5O8 and a molecular weight of 479.41 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-2-[(4-methoxybenzoyl)amino]benzamide.
| Compound Name | N-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-2-[(4-methoxybenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 135715855 |
| Molecular Formula | C22H17N5O8 |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | N-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-2-[(4-methoxybenzoyl)amino]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2C(=O)N/N=C/c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2O)cc1 |
| InChI | InChI=1S/C22H17N5O8/c1-35-16-8-6-13(7-9-16)21(29)24-18-5-3-2-4-17(18)22(30)25-23-12-14-10-15(26(31)32)11-19(20(14)28)27(33)34/h2-12,28H,1H3,(H,24,29)(H,25,30)/b23-12+ |
| InChIKey | HCGWSTRVDQGMLK-FSJBWODESA-N |
| XLogP | 3.23 |
| TPSA | 186.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|