C17H15N5O8 — CID 135514407
N-[2-[(2E)-2-[(2-hydroxy-3,5-dinitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2-methoxybenzamide (PubChem CID 135514407) has the molecular formula C17H15N5O8 and a molecular weight of 417.33 g/mol. Its IUPAC name is N-[2-[(2E)-2-[(2-hydroxy-3,5-dinitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2-methoxybenzamide.
| Compound Name | N-[2-[(2E)-2-[(2-hydroxy-3,5-dinitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 135514407 |
| Molecular Formula | C17H15N5O8 |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | N-[2-[(2E)-2-[(2-hydroxy-3,5-dinitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NCC(=O)N/N=C/c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C17H15N5O8/c1-30-14-5-3-2-4-12(14)17(25)18-9-15(23)20-19-8-10-6-11(21(26)27)7-13(16(10)24)22(28)29/h2-8,24H,9H2,1H3,(H,18,25)(H,20,23)/b19-8+ |
| InChIKey | QHONZSYRNDIFIG-UFWORHAWSA-N |
| XLogP | 1.10 |
| TPSA | 186.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|