C16H11BrN6O8 — CID 4914226
2-bromo-N-[2-oxo-2-[2-[(2,4,6-trinitrophenyl)methylidene]hydrazinyl]ethyl]benzamide (PubChem CID 4914226) has the molecular formula C16H11BrN6O8 and a molecular weight of 495.20 g/mol. Its IUPAC name is 2-bromo-N-[2-oxo-2-[2-[(2,4,6-trinitrophenyl)methylidene]hydrazinyl]ethyl]benzamide.
| Compound Name | 2-bromo-N-[2-oxo-2-[2-[(2,4,6-trinitrophenyl)methylidene]hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 4914226 |
| Molecular Formula | C16H11BrN6O8 |
| Molecular Weight | 495.20 g/mol |
| Exact Mass | 493.98 |
| IUPAC Name | 2-bromo-N-[2-oxo-2-[2-[(2,4,6-trinitrophenyl)methylidene]hydrazinyl]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1Br)NN=Cc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H11BrN6O8/c17-12-4-2-1-3-10(12)16(25)18-8-15(24)20-19-7-11-13(22(28)29)5-9(21(26)27)6-14(11)23(30)31/h1-7H,8H2,(H,18,25)(H,20,24) |
| InChIKey | OYMQGDCQBUITQS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 199.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.20 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|