C14H12BrN5O4 — CID 4265295
2-bromo-N-[2-[2-[(2,4-dioxo-1H-pyrimidin-6-yl)methylidene]hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 4265295) has the molecular formula C14H12BrN5O4 and a molecular weight of 394.19 g/mol. Its IUPAC name is 2-bromo-N-[2-[2-[(2,4-dioxo-1H-pyrimidin-6-yl)methylidene]hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 2-bromo-N-[2-[2-[(2,4-dioxo-1H-pyrimidin-6-yl)methylidene]hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 4265295 |
| Molecular Formula | C14H12BrN5O4 |
| Molecular Weight | 394.19 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 2-bromo-N-[2-[2-[(2,4-dioxo-1H-pyrimidin-6-yl)methylidene]hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1Br)NN=Cc1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C14H12BrN5O4/c15-10-4-2-1-3-9(10)13(23)16-7-12(22)20-17-6-8-5-11(21)19-14(24)18-8/h1-6H,7H2,(H,16,23)(H,20,22)(H2,18,19,21,24) |
| InChIKey | VFPRNASDQPUKDJ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.19 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|