C18H17Br2N3O4 — CID 3379679
2-bromo-N-[2-[2-[(5-bromo-2,4-dihydroxy-3,6-dimethylphenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 3379679) has the molecular formula C18H17Br2N3O4 and a molecular weight of 499.16 g/mol. Its IUPAC name is 2-bromo-N-[2-[2-[(5-bromo-2,4-dihydroxy-3,6-dimethylphenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 2-bromo-N-[2-[2-[(5-bromo-2,4-dihydroxy-3,6-dimethylphenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 3379679 |
| Molecular Formula | C18H17Br2N3O4 |
| Molecular Weight | 499.16 g/mol |
| Exact Mass | 496.96 |
| IUPAC Name | 2-bromo-N-[2-[2-[(5-bromo-2,4-dihydroxy-3,6-dimethylphenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | Cc1c(O)c(Br)c(C)c(C=NNC(=O)CNC(=O)c2ccccc2Br)c1O |
| InChI | InChI=1S/C18H17Br2N3O4/c1-9-12(16(25)10(2)17(26)15(9)20)7-22-23-14(24)8-21-18(27)11-5-3-4-6-13(11)19/h3-7,25-26H,8H2,1-2H3,(H,21,27)(H,23,24) |
| InChIKey | TWTHMNZWWPSAQL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.16 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|