C25H23BrN2O3 — CID 137207035
(1S)-N-[(5-bromo-2,4-dihydroxy-3,6-dimethylphenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide (PubChem CID 137207035) has the molecular formula C25H23BrN2O3 and a molecular weight of 479.37 g/mol. Its IUPAC name is (1S)-N-[(5-bromo-2,4-dihydroxy-3,6-dimethylphenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide.
| Compound Name | (1S)-N-[(5-bromo-2,4-dihydroxy-3,6-dimethylphenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 137207035 |
| Molecular Formula | C25H23BrN2O3 |
| Molecular Weight | 479.37 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | (1S)-N-[(5-bromo-2,4-dihydroxy-3,6-dimethylphenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide |
| SMILES | Cc1c(O)c(Br)c(C)c(C=NNC(=O)[C@H]2CC2(c2ccccc2)c2ccccc2)c1O |
| InChI | InChI=1S/C25H23BrN2O3/c1-15-19(22(29)16(2)23(30)21(15)26)14-27-28-24(31)20-13-25(20,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,14,20,29-30H,13H2,1-2H3,(H,28,31)/t20-/m1/s1 |
| InChIKey | OPTVCBJLRCDYDC-HXUWFJFHSA-N |
| XLogP | 4.93 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.37 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|