C23H18I2N2O2 — CID 136852332
(1S)-N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide (PubChem CID 136852332) has the molecular formula C23H18I2N2O2 and a molecular weight of 608.22 g/mol. Its IUPAC name is (1S)-N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide.
| Compound Name | (1S)-N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 136852332 |
| Molecular Formula | C23H18I2N2O2 |
| Molecular Weight | 608.22 g/mol |
| Exact Mass | 607.95 |
| IUPAC Name | (1S)-N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide |
| SMILES | O=C(N/N=C\c1cc(I)cc(I)c1O)[C@H]1CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H18I2N2O2/c24-18-11-15(21(28)20(25)12-18)14-26-27-22(29)19-13-23(19,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-12,14,19,28H,13H2,(H,27,29)/b26-14-/t19-/m1/s1 |
| InChIKey | YXRFZANKERGZIN-XZXCIOHHSA-N |
| XLogP | 5.06 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.22 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|