C24H19ClN2O3 — CID 5456388
(1R)-N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide (PubChem CID 5456388) has the molecular formula C24H19ClN2O3 and a molecular weight of 418.88 g/mol. Its IUPAC name is (1R)-N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide.
| Compound Name | (1R)-N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 5456388 |
| Molecular Formula | C24H19ClN2O3 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | (1R)-N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide |
| SMILES | O=C(N/N=C\c1cc2c(cc1Cl)OCO2)[C@@H]1CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H19ClN2O3/c25-20-12-22-21(29-15-30-22)11-16(20)14-26-27-23(28)19-13-24(19,17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-12,14,19H,13,15H2,(H,27,28)/b26-14-/t19-/m0/s1 |
| InChIKey | JOZKKKSLDMLEHK-ZNXJRTHMSA-N |
| XLogP | 4.53 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|