C24H20I2N2O2 — CID 129438356
(1R)-N-[(3,5-diiodo-2-methoxyphenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide (PubChem CID 129438356) has the molecular formula C24H20I2N2O2 and a molecular weight of 622.24 g/mol. Its IUPAC name is (1R)-N-[(3,5-diiodo-2-methoxyphenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide.
| Compound Name | (1R)-N-[(3,5-diiodo-2-methoxyphenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 129438356 |
| Molecular Formula | C24H20I2N2O2 |
| Molecular Weight | 622.24 g/mol |
| Exact Mass | 621.96 |
| IUPAC Name | (1R)-N-[(3,5-diiodo-2-methoxyphenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide |
| SMILES | COc1c(I)cc(I)cc1C=NNC(=O)[C@@H]1CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H20I2N2O2/c1-30-22-16(12-19(25)13-21(22)26)15-27-28-23(29)20-14-24(20,17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-13,15,20H,14H2,1H3,(H,28,29)/t20-/m0/s1 |
| InChIKey | FWZUNSQMLOGNRV-FQEVSTJZSA-N |
| XLogP | 5.36 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.24 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|