C25H23BrN2O3 — CID 136852920
(1R)-N-[(Z)-(5-bromo-3-ethoxy-2-hydroxyphenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide (PubChem CID 136852920) has the molecular formula C25H23BrN2O3 and a molecular weight of 479.37 g/mol. Its IUPAC name is (1R)-N-[(Z)-(5-bromo-3-ethoxy-2-hydroxyphenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide.
| Compound Name | (1R)-N-[(Z)-(5-bromo-3-ethoxy-2-hydroxyphenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 136852920 |
| Molecular Formula | C25H23BrN2O3 |
| Molecular Weight | 479.37 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | (1R)-N-[(Z)-(5-bromo-3-ethoxy-2-hydroxyphenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide |
| SMILES | CCOc1cc(Br)cc(/C=N\NC(=O)[C@@H]2CC2(c2ccccc2)c2ccccc2)c1O |
| InChI | InChI=1S/C25H23BrN2O3/c1-2-31-22-14-20(26)13-17(23(22)29)16-27-28-24(30)21-15-25(21,18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-14,16,21,29H,2,15H2,1H3,(H,28,30)/b27-16-/t21-/m0/s1 |
| InChIKey | NQMFDYWEQMFQCJ-LBRHQESJSA-N |
| XLogP | 5.01 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|