C23H19BrN2O2 — CID 136786083
(1S)-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide (PubChem CID 136786083) has the molecular formula C23H19BrN2O2 and a molecular weight of 435.32 g/mol. Its IUPAC name is (1S)-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide.
| Compound Name | (1S)-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 136786083 |
| Molecular Formula | C23H19BrN2O2 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | (1S)-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide |
| SMILES | O=C(N/N=C\c1cc(Br)ccc1O)[C@H]1CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H19BrN2O2/c24-19-11-12-21(27)16(13-19)15-25-26-22(28)20-14-23(20,17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-13,15,20,27H,14H2,(H,26,28)/b25-15-/t20-/m1/s1 |
| InChIKey | UQDSXJMZNZPXMS-UQEONJGVSA-N |
| XLogP | 4.61 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|