C23H19N3O3 — CID 3093090
N-[(2-nitrophenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide (PubChem CID 3093090) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is N-[(2-nitrophenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide.
| Compound Name | N-[(2-nitrophenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 3093090 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N-[(2-nitrophenyl)methylideneamino]-2,2-diphenylcyclopropane-1-carboxamide |
| SMILES | O=C(NN=Cc1ccccc1[N+](=O)[O-])C1CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H19N3O3/c27-22(25-24-16-17-9-7-8-14-21(17)26(28)29)20-15-23(20,18-10-3-1-4-11-18)19-12-5-2-6-13-19/h1-14,16,20H,15H2,(H,25,27) |
| InChIKey | PKWGFZMXQBSFQZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|