C17H15N3O3 — CID 1237032
trans-(1S,2S)-N-[(2-nitrophenyl)methylideneamino]-2-phenylcyclopropane-1-carboxamide (PubChem CID 1237032) has the molecular formula C17H15N3O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is trans-(1S,2S)-N-[(2-nitrophenyl)methylideneamino]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-N-[(2-nitrophenyl)methylideneamino]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 1237032 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | trans-(1S,2S)-N-[(2-nitrophenyl)methylideneamino]-2-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(NN=Cc1ccccc1[N+](=O)[O-])[C@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H15N3O3/c21-17(15-10-14(15)12-6-2-1-3-7-12)19-18-11-13-8-4-5-9-16(13)20(22)23/h1-9,11,14-15H,10H2,(H,19,21)/t14-,15+/m1/s1 |
| InChIKey | CHAMAPUBXFIHQO-CABCVRRESA-N |
| XLogP | 2.85 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|