C23H25N3O3 — CID 7297838
trans-(1S,2S)-2-(4-tert-butylphenyl)-N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]cyclopropane-1-carboxamide (PubChem CID 7297838) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is trans-(1S,2S)-2-(4-tert-butylphenyl)-N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-(4-tert-butylphenyl)-N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7297838 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | trans-(1S,2S)-2-(4-tert-butylphenyl)-N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]cyclopropane-1-carboxamide |
| SMILES | CC(C)(C)c1ccc([C@H]2C[C@@H]2C(=O)N/N=C/C=C/c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H25N3O3/c1-23(2,3)18-12-10-16(11-13-18)19-15-20(19)22(27)25-24-14-6-8-17-7-4-5-9-21(17)26(28)29/h4-14,19-20H,15H2,1-3H3,(H,25,27)/b8-6+,24-14+/t19-,20+/m1/s1 |
| InChIKey | JALFDPXWHNOZGQ-KLIABAIVSA-N |
| XLogP | 4.81 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|