C23H25BrN2O — CID 3717957
N-[(2-bromo-3-phenylprop-2-enylidene)amino]-2-(4-tert-butylphenyl)cyclopropane-1-carboxamide (PubChem CID 3717957) has the molecular formula C23H25BrN2O and a molecular weight of 425.37 g/mol. Its IUPAC name is N-[(2-bromo-3-phenylprop-2-enylidene)amino]-2-(4-tert-butylphenyl)cyclopropane-1-carboxamide.
| Compound Name | N-[(2-bromo-3-phenylprop-2-enylidene)amino]-2-(4-tert-butylphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 3717957 |
| Molecular Formula | C23H25BrN2O |
| Molecular Weight | 425.37 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | N-[(2-bromo-3-phenylprop-2-enylidene)amino]-2-(4-tert-butylphenyl)cyclopropane-1-carboxamide |
| SMILES | CC(C)(C)c1ccc(C2CC2C(=O)NN=CC(Br)=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H25BrN2O/c1-23(2,3)18-11-9-17(10-12-18)20-14-21(20)22(27)26-25-15-19(24)13-16-7-5-4-6-8-16/h4-13,15,20-21H,14H2,1-3H3,(H,26,27) |
| InChIKey | PJCUCTNFONXPRO-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.37 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|