C23H28N2O — CID 7334379
cis-(1S,2R)-2-(4-tert-butylphenyl)-N-[(Z)-[(2S)-2-phenylpropylidene]amino]cyclopropane-1-carboxamide (PubChem CID 7334379) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is cis-(1S,2R)-2-(4-tert-butylphenyl)-N-[(Z)-[(2S)-2-phenylpropylidene]amino]cyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-2-(4-tert-butylphenyl)-N-[(Z)-[(2S)-2-phenylpropylidene]amino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7334379 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | cis-(1S,2R)-2-(4-tert-butylphenyl)-N-[(Z)-[(2S)-2-phenylpropylidene]amino]cyclopropane-1-carboxamide |
| SMILES | C[C@H](/C=N\NC(=O)[C@H]1C[C@H]1c1ccc(C(C)(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H28N2O/c1-16(17-8-6-5-7-9-17)15-24-25-22(26)21-14-20(21)18-10-12-19(13-11-18)23(2,3)4/h5-13,15-16,20-21H,14H2,1-4H3,(H,25,26)/b24-15-/t16-,20+,21+/m1/s1 |
| InChIKey | JBKHYJPKLOHRPL-PVJUFAKSSA-N |
| XLogP | 4.99 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|