C21H23BrN2O — CID 129440790
trans-(1R,2R)-N-[(3-bromophenyl)methylideneamino]-2-(4-tert-butylphenyl)cyclopropane-1-carboxamide (PubChem CID 129440790) has the molecular formula C21H23BrN2O and a molecular weight of 399.33 g/mol. Its IUPAC name is trans-(1R,2R)-N-[(3-bromophenyl)methylideneamino]-2-(4-tert-butylphenyl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-[(3-bromophenyl)methylideneamino]-2-(4-tert-butylphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 129440790 |
| Molecular Formula | C21H23BrN2O |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | trans-(1R,2R)-N-[(3-bromophenyl)methylideneamino]-2-(4-tert-butylphenyl)cyclopropane-1-carboxamide |
| SMILES | CC(C)(C)c1ccc([C@@H]2C[C@H]2C(=O)NN=Cc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C21H23BrN2O/c1-21(2,3)16-9-7-15(8-10-16)18-12-19(18)20(25)24-23-13-14-5-4-6-17(22)11-14/h4-11,13,18-19H,12H2,1-3H3,(H,24,25)/t18-,19+/m0/s1 |
| InChIKey | VQHKECBRQISIAS-RBUKOAKNSA-N |
| XLogP | 5.00 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|