C18H15N3O5 — CID 6555904
trans-(1R,2R)-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-2-phenylcyclopropane-1-carboxamide (PubChem CID 6555904) has the molecular formula C18H15N3O5 and a molecular weight of 353.33 g/mol. Its IUPAC name is trans-(1R,2R)-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 6555904 |
| Molecular Formula | C18H15N3O5 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | trans-(1R,2R)-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-2-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(N/N=C\c1cc2c(cc1[N+](=O)[O-])OCO2)[C@@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H15N3O5/c22-18(14-7-13(14)11-4-2-1-3-5-11)20-19-9-12-6-16-17(26-10-25-16)8-15(12)21(23)24/h1-6,8-9,13-14H,7,10H2,(H,20,22)/b19-9-/t13-,14+/m0/s1 |
| InChIKey | LZSWPWDGFAPBDI-VXMDVLELSA-N |
| XLogP | 2.58 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|