C15H12N4O4S — CID 6175262
1-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-3-phenylthiourea (PubChem CID 6175262) has the molecular formula C15H12N4O4S and a molecular weight of 344.35 g/mol. Its IUPAC name is 1-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-3-phenylthiourea.
| Compound Name | 1-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 6175262 |
| Molecular Formula | C15H12N4O4S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 1-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-3-phenylthiourea |
| SMILES | O=[N+]([O-])c1cc2c(cc1/C=N\NC(=S)Nc1ccccc1)OCO2 |
| InChI | InChI=1S/C15H12N4O4S/c20-19(21)12-7-14-13(22-9-23-14)6-10(12)8-16-18-15(24)17-11-4-2-1-3-5-11/h1-8H,9H2,(H2,17,18,24)/b16-8- |
| InChIKey | YIEORBKFLINUGI-PXNMLYILSA-N |
| XLogP | 2.64 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|